About 1-benzyl-4-but-1-en-2-ylbenzene;4-methylpyrrolidine-2-carboxylic acid
1-benzyl-4-but-1-en-2-ylbenzene;4-methylpyrrolidine-2-carboxylic acid (PubChem CID 163270883) has the molecular formula C23H29NO2
and a molecular weight of 351.49 g/mol. Its IUPAC name is 1-benzyl-4-but-1-en-2-ylbenzene;4-methylpyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-benzyl-4-but-1-en-2-ylbenzene;4-methylpyrrolidine-2-carboxylic acid |
| PubChem CID | 163270883 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 1-benzyl-4-but-1-en-2-ylbenzene;4-methylpyrrolidine-2-carboxylic acid |
| SMILES | C=C(CC)c1ccc(Cc2ccccc2)cc1.CC1CNC(C(=O)O)C1 |
| InChI | InChI=1S/C17H18.C6H11NO2/c1-3-14(2)17-11-9-16(10-12-17)13-15-7-5-4-6-8-15;1-4-2-5(6(8)9)7-3-4/h4-12H,2-3,13H2,1H3;4-5,7H,2-3H2,1H3,(H,8,9) |
| InChIKey | ZRHWSBNKSVIVPS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-4-but-1-en-2-ylbenzene;4-methylpyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-but-1-en-2-ylbenzene;4-methylpyrrolidine-2-carboxylic acid?
The IUPAC name of 1-benzyl-4-but-1-en-2-ylbenzene;4-methylpyrrolidine-2-carboxylic acid (CID 163270883) is 1-benzyl-4-but-1-en-2-ylbenzene;4-methylpyrrolidine-2-carboxylic acid.
What is the SMILES notation for 1-benzyl-4-but-1-en-2-ylbenzene;4-methylpyrrolidine-2-carboxylic acid?
The canonical SMILES for 1-benzyl-4-but-1-en-2-ylbenzene;4-methylpyrrolidine-2-carboxylic acid is C=C(CC)c1ccc(Cc2ccccc2)cc1.CC1CNC(C(=O)O)C1.
What is the InChIKey of 1-benzyl-4-but-1-en-2-ylbenzene;4-methylpyrrolidine-2-carboxylic acid?
The InChIKey is ZRHWSBNKSVIVPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18.C6H11NO2/c1-3-14(2)17-11-9-16(10-12-17)13-15-7-5-4-6-8-15;1-4-2-5(6(8)9)7-3-4/h4-12H,2-3,13H2,1H3;4-5,7H,2-3H2,1H3,(H,8,9).
What are the key properties of 1-benzyl-4-but-1-en-2-ylbenzene;4-methylpyrrolidine-2-carboxylic acid?
1-benzyl-4-but-1-en-2-ylbenzene;4-methylpyrrolidine-2-carboxylic acid has a molecular weight of 351.49 g/mol, XLogP of 4.77, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-but-1-en-2-ylbenzene;4-methylpyrrolidine-2-carboxylic acid is sourced from PubChem (CID 163270883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).