C21H22F5N3O2 — CID 163275733
(2S)-2-amino-2-[(1S)-3,3-difluorocyclohexyl]-N-[4-[2-methyl-1-oxido-4-(trifluoromethyl)pyridin-1-ium-3-yl]phenyl]acetamide (PubChem CID 163275733) has the molecular formula C21H22F5N3O2 and a molecular weight of 443.42 g/mol. Its IUPAC name is (2S)-2-amino-2-[(1S)-3,3-difluorocyclohexyl]-N-[4-[2-methyl-1-oxido-4-(trifluoromethyl)pyridin-1-ium-3-yl]phenyl]acetamide.
| Compound Name | (2S)-2-amino-2-[(1S)-3,3-difluorocyclohexyl]-N-[4-[2-methyl-1-oxido-4-(trifluoromethyl)pyridin-1-ium-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 163275733 |
| Molecular Formula | C21H22F5N3O2 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | (2S)-2-amino-2-[(1S)-3,3-difluorocyclohexyl]-N-[4-[2-methyl-1-oxido-4-(trifluoromethyl)pyridin-1-ium-3-yl]phenyl]acetamide |
| SMILES | Cc1c(-c2ccc(NC(=O)[C@@H](N)[C@H]3CCCC(F)(F)C3)cc2)c(C(F)(F)F)cc[n+]1[O-] |
| InChI | InChI=1S/C21H22F5N3O2/c1-12-17(16(21(24,25)26)8-10-29(12)31)13-4-6-15(7-5-13)28-19(30)18(27)14-3-2-9-20(22,23)11-14/h4-8,10,14,18H,2-3,9,11,27H2,1H3,(H,28,30)/t14-,18-/m0/s1 |
| InChIKey | VLPHNFTXAAIPRL-KSSFIOAISA-N |
| XLogP | 4.41 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|