C20H21Cl2F2N3O2 — CID 170425442
2-amino-N-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)phenyl]-2-[(1R,5S)-6,6-difluoro-3-bicyclo[3.1.0]hexanyl]acetamide;hydrochloride (PubChem CID 170425442) has the molecular formula C20H21Cl2F2N3O2 and a molecular weight of 444.31 g/mol. Its IUPAC name is 2-amino-N-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)phenyl]-2-[(1R,5S)-6,6-difluoro-3-bicyclo[3.1.0]hexanyl]acetamide;hydrochloride.
| Compound Name | 2-amino-N-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)phenyl]-2-[(1R,5S)-6,6-difluoro-3-bicyclo[3.1.0]hexanyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 170425442 |
| Molecular Formula | C20H21Cl2F2N3O2 |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 2-amino-N-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)phenyl]-2-[(1R,5S)-6,6-difluoro-3-bicyclo[3.1.0]hexanyl]acetamide;hydrochloride |
| SMILES | Cc1c(-c2ccc(NC(=O)C(N)C3C[C@@H]4[C@H](C3)C4(F)F)cc2)c(Cl)cc[n+]1[O-].Cl |
| InChI | InChI=1S/C20H20ClF2N3O2.ClH/c1-10-17(16(21)6-7-26(10)28)11-2-4-13(5-3-11)25-19(27)18(24)12-8-14-15(9-12)20(14,22)23;/h2-7,12,14-15,18H,8-9,24H2,1H3,(H,25,27);1H/t12?,14-,15+,18?; |
| InChIKey | FAANYGUGMXPYIA-UJDYBABHSA-N |
| XLogP | 3.93 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|