C22H29N3O2 — CID 175717836
(2S)-2-amino-N-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)phenyl]-2-(4-methylcyclohexyl)acetamide (PubChem CID 175717836) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)phenyl]-2-(4-methylcyclohexyl)acetamide.
| Compound Name | (2S)-2-amino-N-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)phenyl]-2-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 175717836 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | (2S)-2-amino-N-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)phenyl]-2-(4-methylcyclohexyl)acetamide |
| SMILES | Cc1cc[n+]([O-])c(C)c1-c1ccc(NC(=O)[C@@H](N)C2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-14-4-6-18(7-5-14)21(23)22(26)24-19-10-8-17(9-11-19)20-15(2)12-13-25(27)16(20)3/h8-14,18,21H,4-7,23H2,1-3H3,(H,24,26)/t14?,18?,21-/m0/s1 |
| InChIKey | LRGXQKUPIWOGDC-LREWSXEPSA-N |
| XLogP | 3.70 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|