C28H39F3N6O3 — CID 163278614
N-ethyl-N-[1-[5-methoxy-4-[8-[(7R)-10,10,10-trifluoro-7-(methylamino)decoxy]imidazo[1,2-a]pyrazin-6-yl]-2-pyridinyl]ethyl]formamide (PubChem CID 163278614) has the molecular formula C28H39F3N6O3 and a molecular weight of 564.65 g/mol. Its IUPAC name is N-ethyl-N-[1-[5-methoxy-4-[8-[(7R)-10,10,10-trifluoro-7-(methylamino)decoxy]imidazo[1,2-a]pyrazin-6-yl]-2-pyridinyl]ethyl]formamide.
| Compound Name | N-ethyl-N-[1-[5-methoxy-4-[8-[(7R)-10,10,10-trifluoro-7-(methylamino)decoxy]imidazo[1,2-a]pyrazin-6-yl]-2-pyridinyl]ethyl]formamide |
|---|---|
| PubChem CID | 163278614 |
| Molecular Formula | C28H39F3N6O3 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | N-ethyl-N-[1-[5-methoxy-4-[8-[(7R)-10,10,10-trifluoro-7-(methylamino)decoxy]imidazo[1,2-a]pyrazin-6-yl]-2-pyridinyl]ethyl]formamide |
| SMILES | CCN(C=O)C(C)c1cc(-c2cn3ccnc3c(OCCCCCC[C@H](CCC(F)(F)F)NC)n2)c(OC)cn1 |
| InChI | InChI=1S/C28H39F3N6O3/c1-5-36(19-38)20(2)23-16-22(25(39-4)17-34-23)24-18-37-14-13-33-26(37)27(35-24)40-15-9-7-6-8-10-21(32-3)11-12-28(29,30)31/h13-14,16-21,32H,5-12,15H2,1-4H3/t20?,21-/m1/s1 |
| InChIKey | TXXWBGXJLSXZGO-BPGUCPLFSA-N |
| XLogP | 5.60 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|