C22H24F6N6O3 — CID 174220521
1-ethyl-3-(1,1,1-trifluorobutan-2-yl)-1-[2,2,2-trifluoro-1-[5-methoxy-4-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)-2-pyridinyl]ethyl]urea (PubChem CID 174220521) has the molecular formula C22H24F6N6O3 and a molecular weight of 534.46 g/mol. Its IUPAC name is 1-ethyl-3-(1,1,1-trifluorobutan-2-yl)-1-[2,2,2-trifluoro-1-[5-methoxy-4-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)-2-pyridinyl]ethyl]urea.
| Compound Name | 1-ethyl-3-(1,1,1-trifluorobutan-2-yl)-1-[2,2,2-trifluoro-1-[5-methoxy-4-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)-2-pyridinyl]ethyl]urea |
|---|---|
| PubChem CID | 174220521 |
| Molecular Formula | C22H24F6N6O3 |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 1-ethyl-3-(1,1,1-trifluorobutan-2-yl)-1-[2,2,2-trifluoro-1-[5-methoxy-4-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)-2-pyridinyl]ethyl]urea |
| SMILES | CCC(NC(=O)N(CC)C(c1cc(-c2cn3ccnc3c(OC)n2)c(OC)cn1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H24F6N6O3/c1-5-16(21(23,24)25)32-20(35)34(6-2)17(22(26,27)28)13-9-12(15(36-3)10-30-13)14-11-33-8-7-29-18(33)19(31-14)37-4/h7-11,16-17H,5-6H2,1-4H3,(H,32,35) |
| InChIKey | VUERBQSFSNTLPZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |