C22H25F6N7O3 — CID 174220268
1-ethyl-1-[2,2,2-trifluoro-1-[5-methoxy-4-(8-methoxy-[1,2,4]triazolo[1,5-a]pyrazin-6-yl)-2-pyridinyl]ethyl]-3-(1,1,5-trifluoropentan-2-yl)urea (PubChem CID 174220268) has the molecular formula C22H25F6N7O3 and a molecular weight of 549.48 g/mol. Its IUPAC name is 1-ethyl-1-[2,2,2-trifluoro-1-[5-methoxy-4-(8-methoxy-[1,2,4]triazolo[1,5-a]pyrazin-6-yl)-2-pyridinyl]ethyl]-3-(1,1,5-trifluoropentan-2-yl)urea.
| Compound Name | 1-ethyl-1-[2,2,2-trifluoro-1-[5-methoxy-4-(8-methoxy-[1,2,4]triazolo[1,5-a]pyrazin-6-yl)-2-pyridinyl]ethyl]-3-(1,1,5-trifluoropentan-2-yl)urea |
|---|---|
| PubChem CID | 174220268 |
| Molecular Formula | C22H25F6N7O3 |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 1-ethyl-1-[2,2,2-trifluoro-1-[5-methoxy-4-(8-methoxy-[1,2,4]triazolo[1,5-a]pyrazin-6-yl)-2-pyridinyl]ethyl]-3-(1,1,5-trifluoropentan-2-yl)urea |
| SMILES | CCN(C(=O)NC(CCCF)C(F)F)C(c1cc(-c2cn3ncnc3c(OC)n2)c(OC)cn1)C(F)(F)F |
| InChI | InChI=1S/C22H25F6N7O3/c1-4-34(21(36)33-13(18(24)25)6-5-7-23)17(22(26,27)28)14-8-12(16(37-2)9-29-14)15-10-35-19(30-11-31-35)20(32-15)38-3/h8-11,13,17-18H,4-7H2,1-3H3,(H,33,36) |
| InChIKey | YAFGGUPOOMASIJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |