C24H22F9N7O2 — CID 164536470
1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[2,2,2-trifluoro-1-[8-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)imidazo[1,2-a]pyridin-6-yl]ethyl]urea (PubChem CID 164536470) has the molecular formula C24H22F9N7O2 and a molecular weight of 611.47 g/mol. Its IUPAC name is 1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[2,2,2-trifluoro-1-[8-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)imidazo[1,2-a]pyridin-6-yl]ethyl]urea.
| Compound Name | 1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[2,2,2-trifluoro-1-[8-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)imidazo[1,2-a]pyridin-6-yl]ethyl]urea |
|---|---|
| PubChem CID | 164536470 |
| Molecular Formula | C24H22F9N7O2 |
| Molecular Weight | 611.47 g/mol |
| Exact Mass | 611.17 |
| IUPAC Name | 1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[2,2,2-trifluoro-1-[8-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)imidazo[1,2-a]pyridin-6-yl]ethyl]urea |
| SMILES | CCN(C(=O)N[C@@H](CCC(F)(F)F)C(F)(F)F)C(c1cc(-c2cn3ccnc3c(OC)n2)c2nccn2c1)C(F)(F)F |
| InChI | InChI=1S/C24H22F9N7O2/c1-3-40(21(41)37-16(23(28,29)30)4-5-22(25,26)27)17(24(31,32)33)13-10-14(18-34-6-8-38(18)11-13)15-12-39-9-7-35-19(39)20(36-15)42-2/h6-12,16-17H,3-5H2,1-2H3,(H,37,41)/t16-,17?/m0/s1 |
| InChIKey | WQUWHGSZIHDNGC-BHWOMJMDSA-N |
| XLogP | 5.96 |
| TPSA | 89.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.47 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |