C22H24F6N6O2 — CID 164536342
1-ethyl-3-(1,1,1,5,5,5-hexafluoropentan-2-yl)-1-[[4-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)-5-methyl-2-pyridinyl]methyl]urea (PubChem CID 164536342) has the molecular formula C22H24F6N6O2 and a molecular weight of 518.46 g/mol. Its IUPAC name is 1-ethyl-3-(1,1,1,5,5,5-hexafluoropentan-2-yl)-1-[[4-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)-5-methyl-2-pyridinyl]methyl]urea.
| Compound Name | 1-ethyl-3-(1,1,1,5,5,5-hexafluoropentan-2-yl)-1-[[4-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)-5-methyl-2-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 164536342 |
| Molecular Formula | C22H24F6N6O2 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 1-ethyl-3-(1,1,1,5,5,5-hexafluoropentan-2-yl)-1-[[4-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)-5-methyl-2-pyridinyl]methyl]urea |
| SMILES | CCN(Cc1cc(-c2cn3ccnc3c(OC)n2)c(C)cn1)C(=O)NC(CCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H24F6N6O2/c1-4-33(20(35)32-17(22(26,27)28)5-6-21(23,24)25)11-14-9-15(13(2)10-30-14)16-12-34-8-7-29-18(34)19(31-16)36-3/h7-10,12,17H,4-6,11H2,1-3H3,(H,32,35) |
| InChIKey | TWZDGSRKAHMDFE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |