C22H23F3N6O2 — CID 171401193
1-ethyl-1-[(1R)-1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethyl]-3-(1,1,1-trifluoro-3-isocyanopropan-2-yl)urea (PubChem CID 171401193) has the molecular formula C22H23F3N6O2 and a molecular weight of 460.46 g/mol. Its IUPAC name is 1-ethyl-1-[(1R)-1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethyl]-3-(1,1,1-trifluoro-3-isocyanopropan-2-yl)urea.
| Compound Name | 1-ethyl-1-[(1R)-1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethyl]-3-(1,1,1-trifluoro-3-isocyanopropan-2-yl)urea |
|---|---|
| PubChem CID | 171401193 |
| Molecular Formula | C22H23F3N6O2 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 1-ethyl-1-[(1R)-1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethyl]-3-(1,1,1-trifluoro-3-isocyanopropan-2-yl)urea |
| SMILES | [C-]#[N+]CC(NC(=O)N(CC)[C@H](C)c1cccc(-c2cn3ccnc3c(OC)n2)c1)C(F)(F)F |
| InChI | InChI=1S/C22H23F3N6O2/c1-5-31(21(32)29-18(12-26-3)22(23,24)25)14(2)15-7-6-8-16(11-15)17-13-30-10-9-27-19(30)20(28-17)33-4/h6-11,13-14,18H,5,12H2,1-2,4H3,(H,29,32)/t14-,18?/m1/s1 |
| InChIKey | WFHLRMMSFPUDKJ-IKJXHCRLSA-N |
| XLogP | 4.35 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|