C23H23F8N5O2 — CID 164536343
1-(2,2-difluoroethyl)-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethyl]urea (PubChem CID 164536343) has the molecular formula C23H23F8N5O2 and a molecular weight of 553.45 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethyl]urea.
| Compound Name | 1-(2,2-difluoroethyl)-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 164536343 |
| Molecular Formula | C23H23F8N5O2 |
| Molecular Weight | 553.45 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethyl]urea |
| SMILES | COc1nc(-c2cccc(C(C)N(CC(F)F)C(=O)N[C@@H](CCC(F)(F)F)C(F)(F)F)c2)cn2ccnc12 |
| InChI | InChI=1S/C23H23F8N5O2/c1-13(36(12-18(24)25)21(37)34-17(23(29,30)31)6-7-22(26,27)28)14-4-3-5-15(10-14)16-11-35-9-8-32-19(35)20(33-16)38-2/h3-5,8-11,13,17-18H,6-7,12H2,1-2H3,(H,34,37)/t13?,17-/m0/s1 |
| InChIKey | FRGYVMLYSISMKE-RUINGEJQSA-N |
| XLogP | 6.02 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.45 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |