C22H24F3N5O2 — CID 174220560
1-ethyl-1-[(1R)-1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethyl]-3-(1,1,1-trifluorobut-3-en-2-yl)urea (PubChem CID 174220560) has the molecular formula C22H24F3N5O2 and a molecular weight of 447.46 g/mol. Its IUPAC name is 1-ethyl-1-[(1R)-1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethyl]-3-(1,1,1-trifluorobut-3-en-2-yl)urea.
| Compound Name | 1-ethyl-1-[(1R)-1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethyl]-3-(1,1,1-trifluorobut-3-en-2-yl)urea |
|---|---|
| PubChem CID | 174220560 |
| Molecular Formula | C22H24F3N5O2 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 1-ethyl-1-[(1R)-1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethyl]-3-(1,1,1-trifluorobut-3-en-2-yl)urea |
| SMILES | C=CC(NC(=O)N(CC)[C@H](C)c1cccc(-c2cn3ccnc3c(OC)n2)c1)C(F)(F)F |
| InChI | InChI=1S/C22H24F3N5O2/c1-5-18(22(23,24)25)28-21(31)30(6-2)14(3)15-8-7-9-16(12-15)17-13-29-11-10-26-19(29)20(27-17)32-4/h5,7-14,18H,1,6H2,2-4H3,(H,28,31)/t14-,18?/m1/s1 |
| InChIKey | APEMWSXCQUCMFQ-IKJXHCRLSA-N |
| XLogP | 4.61 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|