C30H36F3N5O3 — CID 163278918
1-[(1R)-1-[4-(8-but-3-enoxy-1,7-naphthyridin-6-yl)-5-methoxy-2-pyridinyl]ethyl]-1-ethyl-3-[(4S)-7,7,7-trifluorohept-1-en-4-yl]urea (PubChem CID 163278918) has the molecular formula C30H36F3N5O3 and a molecular weight of 571.64 g/mol. Its IUPAC name is 1-[(1R)-1-[4-(8-but-3-enoxy-1,7-naphthyridin-6-yl)-5-methoxy-2-pyridinyl]ethyl]-1-ethyl-3-[(4S)-7,7,7-trifluorohept-1-en-4-yl]urea.
| Compound Name | 1-[(1R)-1-[4-(8-but-3-enoxy-1,7-naphthyridin-6-yl)-5-methoxy-2-pyridinyl]ethyl]-1-ethyl-3-[(4S)-7,7,7-trifluorohept-1-en-4-yl]urea |
|---|---|
| PubChem CID | 163278918 |
| Molecular Formula | C30H36F3N5O3 |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | 1-[(1R)-1-[4-(8-but-3-enoxy-1,7-naphthyridin-6-yl)-5-methoxy-2-pyridinyl]ethyl]-1-ethyl-3-[(4S)-7,7,7-trifluorohept-1-en-4-yl]urea |
| SMILES | C=CCCOc1nc(-c2cc([C@@H](C)N(CC)C(=O)N[C@H](CC=C)CCC(F)(F)F)ncc2OC)cc2cccnc12 |
| InChI | InChI=1S/C30H36F3N5O3/c1-6-9-16-41-28-27-21(12-10-15-34-27)17-25(37-28)23-18-24(35-19-26(23)40-5)20(4)38(8-3)29(39)36-22(11-7-2)13-14-30(31,32)33/h6-7,10,12,15,17-20,22H,1-2,8-9,11,13-14,16H2,3-5H3,(H,36,39)/t20-,22-/m1/s1 |
| InChIKey | DPUBKTDVWQIBPJ-IFMALSPDSA-N |
| XLogP | 7.03 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|