C27H33F3N6O2 — CID 163278715
1-[1-[4-(8-but-3-enoxyimidazo[1,2-b]pyridazin-6-yl)-5-fluoro-2-pyridinyl]ethyl]-3-(7,7-difluorohept-1-en-4-yl)-1-ethylurea (PubChem CID 163278715) has the molecular formula C27H33F3N6O2 and a molecular weight of 530.60 g/mol. Its IUPAC name is 1-[1-[4-(8-but-3-enoxyimidazo[1,2-b]pyridazin-6-yl)-5-fluoro-2-pyridinyl]ethyl]-3-(7,7-difluorohept-1-en-4-yl)-1-ethylurea.
| Compound Name | 1-[1-[4-(8-but-3-enoxyimidazo[1,2-b]pyridazin-6-yl)-5-fluoro-2-pyridinyl]ethyl]-3-(7,7-difluorohept-1-en-4-yl)-1-ethylurea |
|---|---|
| PubChem CID | 163278715 |
| Molecular Formula | C27H33F3N6O2 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | 1-[1-[4-(8-but-3-enoxyimidazo[1,2-b]pyridazin-6-yl)-5-fluoro-2-pyridinyl]ethyl]-3-(7,7-difluorohept-1-en-4-yl)-1-ethylurea |
| SMILES | C=CCCOc1cc(-c2cc(C(C)N(CC)C(=O)NC(CC=C)CCC(F)F)ncc2F)nn2ccnc12 |
| InChI | InChI=1S/C27H33F3N6O2/c1-5-8-14-38-24-16-23(34-36-13-12-31-26(24)36)20-15-22(32-17-21(20)28)18(4)35(7-3)27(37)33-19(9-6-2)10-11-25(29)30/h5-6,12-13,15-19,25H,1-2,7-11,14H2,3-4H3,(H,33,37) |
| InChIKey | OKOOTKCBOTTWNM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|