C24H33N5O3S — CID 163278373
1-[4-(8-but-3-enoxyimidazo[1,2-b]pyridazin-6-yl)-5-methoxy-2-pyridinyl]-N-butoxysulfanyl-N-ethylethanamine (PubChem CID 163278373) has the molecular formula C24H33N5O3S and a molecular weight of 471.63 g/mol. Its IUPAC name is 1-[4-(8-but-3-enoxyimidazo[1,2-b]pyridazin-6-yl)-5-methoxy-2-pyridinyl]-N-butoxysulfanyl-N-ethylethanamine.
| Compound Name | 1-[4-(8-but-3-enoxyimidazo[1,2-b]pyridazin-6-yl)-5-methoxy-2-pyridinyl]-N-butoxysulfanyl-N-ethylethanamine |
|---|---|
| PubChem CID | 163278373 |
| Molecular Formula | C24H33N5O3S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 1-[4-(8-but-3-enoxyimidazo[1,2-b]pyridazin-6-yl)-5-methoxy-2-pyridinyl]-N-butoxysulfanyl-N-ethylethanamine |
| SMILES | C=CCCOc1cc(-c2cc(C(C)N(CC)SOCCCC)ncc2OC)nn2ccnc12 |
| InChI | InChI=1S/C24H33N5O3S/c1-6-9-13-31-22-16-21(27-28-12-11-25-24(22)28)19-15-20(26-17-23(19)30-5)18(4)29(8-3)33-32-14-10-7-2/h6,11-12,15-18H,1,7-10,13-14H2,2-5H3 |
| InChIKey | YLMRTSJZSJDMNA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 74.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|