C9H9ClN4O — CID 163278334
4-but-3-enoxy-2-chloroimidazo[2,1-f][1,2,4]triazine (PubChem CID 163278334) has the molecular formula C9H9ClN4O and a molecular weight of 224.65 g/mol. Its IUPAC name is 4-but-3-enoxy-2-chloroimidazo[2,1-f][1,2,4]triazine.
| Compound Name | 4-but-3-enoxy-2-chloroimidazo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 163278334 |
| Molecular Formula | C9H9ClN4O |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 4-but-3-enoxy-2-chloroimidazo[2,1-f][1,2,4]triazine |
| SMILES | C=CCCOc1nc(Cl)nn2ccnc12 |
| InChI | InChI=1S/C9H9ClN4O/c1-2-3-6-15-8-7-11-4-5-14(7)13-9(10)12-8/h2,4-5H,1,3,6H2 |
| InChIKey | RVGCDQVQJOZFJP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|