C11H8Cl2N6O — CID 178019492
2-chloro-N-(2-chloro-3-methoxy-4-pyridinyl)imidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 178019492) has the molecular formula C11H8Cl2N6O and a molecular weight of 311.13 g/mol. Its IUPAC name is 2-chloro-N-(2-chloro-3-methoxy-4-pyridinyl)imidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-chloro-N-(2-chloro-3-methoxy-4-pyridinyl)imidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 178019492 |
| Molecular Formula | C11H8Cl2N6O |
| Molecular Weight | 311.13 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 2-chloro-N-(2-chloro-3-methoxy-4-pyridinyl)imidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | COc1c(Nc2nc(Cl)nn3ccnc23)ccnc1Cl |
| InChI | InChI=1S/C11H8Cl2N6O/c1-20-7-6(2-3-14-8(7)12)16-9-10-15-4-5-19(10)18-11(13)17-9/h2-5H,1H3,(H,14,16,17,18) |
| InChIKey | HIKRJTHIAIPRIZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.13 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|