C17H19N5O2 — CID 121419427
8-N-cyclopropyl-6-N-(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazine-6,8-diamine (PubChem CID 121419427) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 8-N-cyclopropyl-6-N-(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazine-6,8-diamine.
| Compound Name | 8-N-cyclopropyl-6-N-(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazine-6,8-diamine |
|---|---|
| PubChem CID | 121419427 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 8-N-cyclopropyl-6-N-(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazine-6,8-diamine |
| SMILES | COc1ccc(Nc2cc(NC3CC3)c3nccn3n2)cc1OC |
| InChI | InChI=1S/C17H19N5O2/c1-23-14-6-5-12(9-15(14)24-2)20-16-10-13(19-11-3-4-11)17-18-7-8-22(17)21-16/h5-11,19H,3-4H2,1-2H3,(H,20,21) |
| InChIKey | NMWZWGJCKJWOQL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|