C20H20N4O2 — CID 163278078
1-[4-(8-but-3-enoxyimidazo[1,2-a]pyrazin-6-yl)-5-cyclopropyl-2-pyridinyl]ethanone (PubChem CID 163278078) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 1-[4-(8-but-3-enoxyimidazo[1,2-a]pyrazin-6-yl)-5-cyclopropyl-2-pyridinyl]ethanone.
| Compound Name | 1-[4-(8-but-3-enoxyimidazo[1,2-a]pyrazin-6-yl)-5-cyclopropyl-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 163278078 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[4-(8-but-3-enoxyimidazo[1,2-a]pyrazin-6-yl)-5-cyclopropyl-2-pyridinyl]ethanone |
| SMILES | C=CCCOc1nc(-c2cc(C(C)=O)ncc2C2CC2)cn2ccnc12 |
| InChI | InChI=1S/C20H20N4O2/c1-3-4-9-26-20-19-21-7-8-24(19)12-18(23-20)15-10-17(13(2)25)22-11-16(15)14-5-6-14/h3,7-8,10-12,14H,1,4-6,9H2,2H3 |
| InChIKey | WVMVYKMBTAGFMV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|