C25H33N5O4 — CID 163278689
tert-butyl N-[(1R)-1-[5-(8-but-3-enoxyimidazo[1,2-a]pyrazin-6-yl)-4-cyclopropyl-1,3-oxazol-2-yl]ethyl]-N-ethylcarbamate (PubChem CID 163278689) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[5-(8-but-3-enoxyimidazo[1,2-a]pyrazin-6-yl)-4-cyclopropyl-1,3-oxazol-2-yl]ethyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[(1R)-1-[5-(8-but-3-enoxyimidazo[1,2-a]pyrazin-6-yl)-4-cyclopropyl-1,3-oxazol-2-yl]ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 163278689 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | tert-butyl N-[(1R)-1-[5-(8-but-3-enoxyimidazo[1,2-a]pyrazin-6-yl)-4-cyclopropyl-1,3-oxazol-2-yl]ethyl]-N-ethylcarbamate |
| SMILES | C=CCCOc1nc(-c2oc([C@@H](C)N(CC)C(=O)OC(C)(C)C)nc2C2CC2)cn2ccnc12 |
| InChI | InChI=1S/C25H33N5O4/c1-7-9-14-32-23-21-26-12-13-29(21)15-18(27-23)20-19(17-10-11-17)28-22(33-20)16(3)30(8-2)24(31)34-25(4,5)6/h7,12-13,15-17H,1,8-11,14H2,2-6H3/t16-/m1/s1 |
| InChIKey | KCUXZIBSMWVGLL-MRXNPFEDSA-N |
| XLogP | 5.53 |
| TPSA | 94.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|