C10H10ClN5O — CID 55124288
2-but-3-enoxy-4-chloro-6-imidazol-1-yl-1,3,5-triazine (PubChem CID 55124288) has the molecular formula C10H10ClN5O and a molecular weight of 251.68 g/mol. Its IUPAC name is 2-but-3-enoxy-4-chloro-6-imidazol-1-yl-1,3,5-triazine.
| Compound Name | 2-but-3-enoxy-4-chloro-6-imidazol-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 55124288 |
| Molecular Formula | C10H10ClN5O |
| Molecular Weight | 251.68 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-but-3-enoxy-4-chloro-6-imidazol-1-yl-1,3,5-triazine |
| SMILES | C=CCCOc1nc(Cl)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C10H10ClN5O/c1-2-3-6-17-10-14-8(11)13-9(15-10)16-5-4-12-7-16/h2,4-5,7H,1,3,6H2 |
| InChIKey | VMPPZCLMGOJECK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.68 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|