C27H35F2N7O3 — CID 163278741
1-[[5-(4-but-3-enoxyimidazo[2,1-f][1,2,4]triazin-2-yl)-6-methoxy-3-pyridinyl]methyl]-3-[(4S)-7,7-difluorooct-1-en-4-yl]-1-ethylurea (PubChem CID 163278741) has the molecular formula C27H35F2N7O3 and a molecular weight of 543.62 g/mol. Its IUPAC name is 1-[[5-(4-but-3-enoxyimidazo[2,1-f][1,2,4]triazin-2-yl)-6-methoxy-3-pyridinyl]methyl]-3-[(4S)-7,7-difluorooct-1-en-4-yl]-1-ethylurea.
| Compound Name | 1-[[5-(4-but-3-enoxyimidazo[2,1-f][1,2,4]triazin-2-yl)-6-methoxy-3-pyridinyl]methyl]-3-[(4S)-7,7-difluorooct-1-en-4-yl]-1-ethylurea |
|---|---|
| PubChem CID | 163278741 |
| Molecular Formula | C27H35F2N7O3 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 1-[[5-(4-but-3-enoxyimidazo[2,1-f][1,2,4]triazin-2-yl)-6-methoxy-3-pyridinyl]methyl]-3-[(4S)-7,7-difluorooct-1-en-4-yl]-1-ethylurea |
| SMILES | C=CCCOc1nc(-c2cc(CN(CC)C(=O)N[C@H](CC=C)CCC(C)(F)F)cnc2OC)nn2ccnc12 |
| InChI | InChI=1S/C27H35F2N7O3/c1-6-9-15-39-25-23-30-13-14-36(23)34-22(33-25)21-16-19(17-31-24(21)38-5)18-35(8-3)26(37)32-20(10-7-2)11-12-27(4,28)29/h6-7,13-14,16-17,20H,1-2,8-12,15,18H2,3-5H3,(H,32,37)/t20-/m1/s1 |
| InChIKey | OYVOEEHTUXKKCP-HXUWFJFHSA-N |
| XLogP | 5.06 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|