C21H26N4O2 — CID 163278965
(1R)-1-[6-(8-but-3-enoxyimidazo[1,2-a]pyridin-6-yl)-5-methoxy-2-pyridinyl]-N-ethylethanamine (PubChem CID 163278965) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is (1R)-1-[6-(8-but-3-enoxyimidazo[1,2-a]pyridin-6-yl)-5-methoxy-2-pyridinyl]-N-ethylethanamine.
| Compound Name | (1R)-1-[6-(8-but-3-enoxyimidazo[1,2-a]pyridin-6-yl)-5-methoxy-2-pyridinyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 163278965 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (1R)-1-[6-(8-but-3-enoxyimidazo[1,2-a]pyridin-6-yl)-5-methoxy-2-pyridinyl]-N-ethylethanamine |
| SMILES | C=CCCOc1cc(-c2nc([C@@H](C)NCC)ccc2OC)cn2ccnc12 |
| InChI | InChI=1S/C21H26N4O2/c1-5-7-12-27-19-13-16(14-25-11-10-23-21(19)25)20-18(26-4)9-8-17(24-20)15(3)22-6-2/h5,8-11,13-15,22H,1,6-7,12H2,2-4H3/t15-/m1/s1 |
| InChIKey | AGFCBAASYUVJSE-OAHLLOKOSA-N |
| XLogP | 4.03 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|