C22H25N5O2 — CID 163278238
1-[7-(8-but-3-enoxy-2-methylimidazo[1,2-a]pyrazin-6-yl)furo[3,2-b]pyridin-5-yl]-N-ethylethanamine (PubChem CID 163278238) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 1-[7-(8-but-3-enoxy-2-methylimidazo[1,2-a]pyrazin-6-yl)furo[3,2-b]pyridin-5-yl]-N-ethylethanamine.
| Compound Name | 1-[7-(8-but-3-enoxy-2-methylimidazo[1,2-a]pyrazin-6-yl)furo[3,2-b]pyridin-5-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 163278238 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 1-[7-(8-but-3-enoxy-2-methylimidazo[1,2-a]pyrazin-6-yl)furo[3,2-b]pyridin-5-yl]-N-ethylethanamine |
| SMILES | C=CCCOc1nc(-c2cc(C(C)NCC)nc3ccoc23)cn2cc(C)nc12 |
| InChI | InChI=1S/C22H25N5O2/c1-5-7-9-29-22-21-24-14(3)12-27(21)13-19(26-22)16-11-18(15(4)23-6-2)25-17-8-10-28-20(16)17/h5,8,10-13,15,23H,1,6-7,9H2,2-4H3 |
| InChIKey | UBIDEYFRSFSEDY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|