C25H25F3N4O5 — CID 163279869
(7R)-7-(difluoromethyl)-2-[3-[[(2R)-1,4-dioxan-2-yl]methoxy]-4-pyridinyl]-3-(3-fluoro-2-methoxyanilino)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 163279869) has the molecular formula C25H25F3N4O5 and a molecular weight of 518.49 g/mol. Its IUPAC name is (7R)-7-(difluoromethyl)-2-[3-[[(2R)-1,4-dioxan-2-yl]methoxy]-4-pyridinyl]-3-(3-fluoro-2-methoxyanilino)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | (7R)-7-(difluoromethyl)-2-[3-[[(2R)-1,4-dioxan-2-yl]methoxy]-4-pyridinyl]-3-(3-fluoro-2-methoxyanilino)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 163279869 |
| Molecular Formula | C25H25F3N4O5 |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | (7R)-7-(difluoromethyl)-2-[3-[[(2R)-1,4-dioxan-2-yl]methoxy]-4-pyridinyl]-3-(3-fluoro-2-methoxyanilino)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | COc1c(F)cccc1Nc1c(-c2ccncc2OC[C@H]2COCCO2)[nH]c2c1C(=O)NC[C@H]2C(F)F |
| InChI | InChI=1S/C25H25F3N4O5/c1-34-23-16(26)3-2-4-17(23)31-22-19-20(15(24(27)28)9-30-25(19)33)32-21(22)14-5-6-29-10-18(14)37-12-13-11-35-7-8-36-13/h2-6,10,13,15,24,31-32H,7-9,11-12H2,1H3,(H,30,33)/t13-,15-/m1/s1 |
| InChIKey | RZLREPYTQQIIFF-UKRRQHHQSA-N |
| XLogP | 3.85 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |