C27H29FN4O5 — CID 163280120
9-[3-[(5,5-dimethyl-1,4-dioxan-2-yl)methoxy]-4-pyridinyl]-8-(3-fluoro-2-methoxyanilino)-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one (PubChem CID 163280120) has the molecular formula C27H29FN4O5 and a molecular weight of 508.55 g/mol. Its IUPAC name is 9-[3-[(5,5-dimethyl-1,4-dioxan-2-yl)methoxy]-4-pyridinyl]-8-(3-fluoro-2-methoxyanilino)-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one.
| Compound Name | 9-[3-[(5,5-dimethyl-1,4-dioxan-2-yl)methoxy]-4-pyridinyl]-8-(3-fluoro-2-methoxyanilino)-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one |
|---|---|
| PubChem CID | 163280120 |
| Molecular Formula | C27H29FN4O5 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 9-[3-[(5,5-dimethyl-1,4-dioxan-2-yl)methoxy]-4-pyridinyl]-8-(3-fluoro-2-methoxyanilino)-5,10-diazatricyclo[5.3.0.02,4]deca-1(7),8-dien-6-one |
| SMILES | COc1c(F)cccc1Nc1c(-c2ccncc2OCC2COC(C)(C)CO2)[nH]c2c1C(=O)NC1CC21 |
| InChI | InChI=1S/C27H29FN4O5/c1-27(2)13-36-14(12-37-27)11-35-20-10-29-8-7-15(20)23-24(30-18-6-4-5-17(28)25(18)34-3)21-22(32-23)16-9-19(16)31-26(21)33/h4-8,10,14,16,19,30,32H,9,11-13H2,1-3H3,(H,31,33) |
| InChIKey | LBCMSGXFFFESHV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |