C27H29FN4O4 — CID 167052462
(2R,5S)-10-[3-[[(2R)-3,3-dimethyloxetan-2-yl]methoxy]-4-pyridinyl]-9-(3-fluoro-2-methoxyanilino)-6,11-diazatricyclo[6.3.0.02,5]undeca-1(8),9-dien-7-one (PubChem CID 167052462) has the molecular formula C27H29FN4O4 and a molecular weight of 492.55 g/mol. Its IUPAC name is (2R,5S)-10-[3-[[(2R)-3,3-dimethyloxetan-2-yl]methoxy]-4-pyridinyl]-9-(3-fluoro-2-methoxyanilino)-6,11-diazatricyclo[6.3.0.02,5]undeca-1(8),9-dien-7-one.
| Compound Name | (2R,5S)-10-[3-[[(2R)-3,3-dimethyloxetan-2-yl]methoxy]-4-pyridinyl]-9-(3-fluoro-2-methoxyanilino)-6,11-diazatricyclo[6.3.0.02,5]undeca-1(8),9-dien-7-one |
|---|---|
| PubChem CID | 167052462 |
| Molecular Formula | C27H29FN4O4 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | (2R,5S)-10-[3-[[(2R)-3,3-dimethyloxetan-2-yl]methoxy]-4-pyridinyl]-9-(3-fluoro-2-methoxyanilino)-6,11-diazatricyclo[6.3.0.02,5]undeca-1(8),9-dien-7-one |
| SMILES | COc1c(F)cccc1Nc1c(-c2ccncc2OC[C@@H]2OCC2(C)C)[nH]c2c1C(=O)N[C@H]1CC[C@@H]21 |
| InChI | InChI=1S/C27H29FN4O4/c1-27(2)13-36-20(27)12-35-19-11-29-10-9-15(19)23-24(30-18-6-4-5-16(28)25(18)34-3)21-22(32-23)14-7-8-17(14)31-26(21)33/h4-6,9-11,14,17,20,30,32H,7-8,12-13H2,1-3H3,(H,31,33)/t14-,17+,20+/m1/s1 |
| InChIKey | PSBFNVUEARIACW-LIVBEALHSA-N |
| XLogP | 4.76 |
| TPSA | 97.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |