C27H29N3O5 — CID 163280306
4-tert-butyl-N-hydroxybenzamide;6-morpholin-4-ylbenzo[de]isoquinoline-1,3-dione (PubChem CID 163280306) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is 4-tert-butyl-N-hydroxybenzamide;6-morpholin-4-ylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 4-tert-butyl-N-hydroxybenzamide;6-morpholin-4-ylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 163280306 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 4-tert-butyl-N-hydroxybenzamide;6-morpholin-4-ylbenzo[de]isoquinoline-1,3-dione |
| SMILES | CC(C)(C)c1ccc(C(=O)NO)cc1.O=C1NC(=O)c2ccc(N3CCOCC3)c3cccc1c23 |
| InChI | InChI=1S/C16H14N2O3.C11H15NO2/c19-15-11-3-1-2-10-13(18-6-8-21-9-7-18)5-4-12(14(10)11)16(20)17-15;1-11(2,3)9-6-4-8(5-7-9)10(13)12-14/h1-5H,6-9H2,(H,17,19,20);4-7,14H,1-3H3,(H,12,13) |
| InChIKey | ILKSSAZWWOENOK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|