C22H22FN7O — CID 163281456
4-amino-2-[[5-(3-ethyl-5-fluorophenyl)-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]phenol (PubChem CID 163281456) has the molecular formula C22H22FN7O and a molecular weight of 419.46 g/mol. Its IUPAC name is 4-amino-2-[[5-(3-ethyl-5-fluorophenyl)-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]phenol.
| Compound Name | 4-amino-2-[[5-(3-ethyl-5-fluorophenyl)-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 163281456 |
| Molecular Formula | C22H22FN7O |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 4-amino-2-[[5-(3-ethyl-5-fluorophenyl)-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]phenol |
| SMILES | CCc1cc(F)cc(-c2cnc(Nc3cnn(C)c3)nc2Nc2cc(N)ccc2O)c1 |
| InChI | InChI=1S/C22H22FN7O/c1-3-13-6-14(8-15(23)7-13)18-11-25-22(27-17-10-26-30(2)12-17)29-21(18)28-19-9-16(24)4-5-20(19)31/h4-12,31H,3,24H2,1-2H3,(H2,25,27,28,29) |
| InChIKey | VZNRPNDGQSMZRV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|