C15H14F3N — CID 163282328
1,3-dimethyl-6-(trifluoromethyl)-1,2-dihydrobenzo[e]indole (PubChem CID 163282328) has the molecular formula C15H14F3N and a molecular weight of 265.28 g/mol. Its IUPAC name is 1,3-dimethyl-6-(trifluoromethyl)-1,2-dihydrobenzo[e]indole.
| Compound Name | 1,3-dimethyl-6-(trifluoromethyl)-1,2-dihydrobenzo[e]indole |
|---|---|
| PubChem CID | 163282328 |
| Molecular Formula | C15H14F3N |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1,3-dimethyl-6-(trifluoromethyl)-1,2-dihydrobenzo[e]indole |
| SMILES | CC1CN(C)c2ccc3c(C(F)(F)F)cccc3c21 |
| InChI | InChI=1S/C15H14F3N/c1-9-8-19(2)13-7-6-10-11(14(9)13)4-3-5-12(10)15(16,17)18/h3-7,9H,8H2,1-2H3 |
| InChIKey | LJAYBBMYLITYKP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |