C16H18BrN — CID 163282285
6-bromo-1-methyl-3-propan-2-yl-1,2-dihydrobenzo[e]indole (PubChem CID 163282285) has the molecular formula C16H18BrN and a molecular weight of 304.23 g/mol. Its IUPAC name is 6-bromo-1-methyl-3-propan-2-yl-1,2-dihydrobenzo[e]indole.
| Compound Name | 6-bromo-1-methyl-3-propan-2-yl-1,2-dihydrobenzo[e]indole |
|---|---|
| PubChem CID | 163282285 |
| Molecular Formula | C16H18BrN |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 6-bromo-1-methyl-3-propan-2-yl-1,2-dihydrobenzo[e]indole |
| SMILES | CC1CN(C(C)C)c2ccc3c(Br)cccc3c21 |
| InChI | InChI=1S/C16H18BrN/c1-10(2)18-9-11(3)16-13-5-4-6-14(17)12(13)7-8-15(16)18/h4-8,10-11H,9H2,1-3H3 |
| InChIKey | GIYGRYBENJNTGZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |