C14H14ClN3 — CID 155408366
6-chloro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide (PubChem CID 155408366) has the molecular formula C14H14ClN3 and a molecular weight of 259.74 g/mol. Its IUPAC name is 6-chloro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide.
| Compound Name | 6-chloro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide |
|---|---|
| PubChem CID | 155408366 |
| Molecular Formula | C14H14ClN3 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 6-chloro-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC(C)c2c1ccc1c(Cl)cccc21 |
| InChI | InChI=1S/C14H14ClN3/c1-8-7-18(14(16)17)12-6-5-9-10(13(8)12)3-2-4-11(9)15/h2-6,8H,7H2,1H3,(H3,16,17) |
| InChIKey | LMQZHSDPBOPUCU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|