C21H18BrFN2 — CID 167650269
1-(6-bromo-1-methyl-1,2-dihydrobenzo[e]indol-3-yl)-2-(4-fluorophenyl)ethanimine (PubChem CID 167650269) has the molecular formula C21H18BrFN2 and a molecular weight of 397.29 g/mol. Its IUPAC name is 1-(6-bromo-1-methyl-1,2-dihydrobenzo[e]indol-3-yl)-2-(4-fluorophenyl)ethanimine.
| Compound Name | 1-(6-bromo-1-methyl-1,2-dihydrobenzo[e]indol-3-yl)-2-(4-fluorophenyl)ethanimine |
|---|---|
| PubChem CID | 167650269 |
| Molecular Formula | C21H18BrFN2 |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 1-(6-bromo-1-methyl-1,2-dihydrobenzo[e]indol-3-yl)-2-(4-fluorophenyl)ethanimine |
| SMILES | [H]/N=C(/Cc1ccc(F)cc1)N1CC(C)c2c1ccc1c(Br)cccc21 |
| InChI | InChI=1S/C21H18BrFN2/c1-13-12-25(20(24)11-14-5-7-15(23)8-6-14)19-10-9-16-17(21(13)19)3-2-4-18(16)22/h2-10,13,24H,11-12H2,1H3/b24-20- |
| InChIKey | QLYYETHKFHQDKJ-GFMRDNFCSA-N |
| XLogP | 5.88 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|