About 5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride
5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride (PubChem CID 164929792) has the molecular formula C15H18ClN3O
and a molecular weight of 291.78 g/mol. Its IUPAC name is 5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride.
Molecular Properties
| Compound Name | 5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride |
| PubChem CID | 164929792 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CC(C)c2c1cc(OC)c1ccccc21 |
| InChI | InChI=1S/C15H17N3O.ClH/c1-9-8-18(15(16)17)12-7-13(19-2)10-5-3-4-6-11(10)14(9)12;/h3-7,9H,8H2,1-2H3,(H3,16,17);1H |
| InChIKey | UCRAVARQYUNVCU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride?
The IUPAC name of 5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride (CID 164929792) is 5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride.
What is the SMILES notation for 5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride?
The canonical SMILES for 5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride is Cl.[H]/N=C(\N)N1CC(C)c2c1cc(OC)c1ccccc21.
What is the InChIKey of 5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride?
The InChIKey is UCRAVARQYUNVCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O.ClH/c1-9-8-18(15(16)17)12-7-13(19-2)10-5-3-4-6-11(10)14(9)12;/h3-7,9H,8H2,1-2H3,(H3,16,17);1H.
What are the key properties of 5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride?
5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride has a molecular weight of 291.78 g/mol, XLogP of 3.09, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride is sourced from PubChem (CID 164929792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).