C15H18ClN3O — CID 164929792
5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride (PubChem CID 164929792) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is 5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride.
| Compound Name | 5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 164929792 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 5-methoxy-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CC(C)c2c1cc(OC)c1ccccc21 |
| InChI | InChI=1S/C15H17N3O.ClH/c1-9-8-18(15(16)17)12-7-13(19-2)10-5-3-4-6-11(10)14(9)12;/h3-7,9H,8H2,1-2H3,(H3,16,17);1H |
| InChIKey | UCRAVARQYUNVCU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|