C21H19BrN2 — CID 167696149
1-(6-bromo-1-methyl-1,2-dihydrobenzo[e]indol-3-yl)-2-phenylethanimine (PubChem CID 167696149) has the molecular formula C21H19BrN2 and a molecular weight of 379.30 g/mol. Its IUPAC name is 1-(6-bromo-1-methyl-1,2-dihydrobenzo[e]indol-3-yl)-2-phenylethanimine.
| Compound Name | 1-(6-bromo-1-methyl-1,2-dihydrobenzo[e]indol-3-yl)-2-phenylethanimine |
|---|---|
| PubChem CID | 167696149 |
| Molecular Formula | C21H19BrN2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 1-(6-bromo-1-methyl-1,2-dihydrobenzo[e]indol-3-yl)-2-phenylethanimine |
| SMILES | [H]/N=C(/Cc1ccccc1)N1CC(C)c2c1ccc1c(Br)cccc21 |
| InChI | InChI=1S/C21H19BrN2/c1-14-13-24(20(23)12-15-6-3-2-4-7-15)19-11-10-16-17(21(14)19)8-5-9-18(16)22/h2-11,14,23H,12-13H2,1H3/b23-20- |
| InChIKey | XRLNONLHXXOFLN-ATJXCDBQSA-N |
| XLogP | 5.75 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|