C18H16F3N3O2 — CID 167661492
6-ethynyl-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 167661492) has the molecular formula C18H16F3N3O2 and a molecular weight of 363.34 g/mol. Its IUPAC name is 6-ethynyl-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 6-ethynyl-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167661492 |
| Molecular Formula | C18H16F3N3O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 6-ethynyl-1-methyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)N1CC(C)c2c1ccc1c(C#C)cccc21 |
| InChI | InChI=1S/C16H15N3.C2HF3O2/c1-3-11-5-4-6-13-12(11)7-8-14-15(13)10(2)9-19(14)16(17)18;3-2(4,5)1(6)7/h1,4-8,10H,9H2,2H3,(H3,17,18);(H,6,7) |
| InChIKey | AAYGHSWUEWFLMC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|