C26H18N2O3 — CID 163283711
1-phenyl-3-(3-phenylprop-2-enoxy)benzo[f]indazole-4,9-dione (PubChem CID 163283711) has the molecular formula C26H18N2O3 and a molecular weight of 406.44 g/mol. Its IUPAC name is 1-phenyl-3-(3-phenylprop-2-enoxy)benzo[f]indazole-4,9-dione.
| Compound Name | 1-phenyl-3-(3-phenylprop-2-enoxy)benzo[f]indazole-4,9-dione |
|---|---|
| PubChem CID | 163283711 |
| Molecular Formula | C26H18N2O3 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 1-phenyl-3-(3-phenylprop-2-enoxy)benzo[f]indazole-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1c(OCC=Cc1ccccc1)nn2-c1ccccc1 |
| InChI | InChI=1S/C26H18N2O3/c29-24-20-15-7-8-16-21(20)25(30)23-22(24)26(27-28(23)19-13-5-2-6-14-19)31-17-9-12-18-10-3-1-4-11-18/h1-16H,17H2 |
| InChIKey | IAGZTOJVDRTTCN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|