C21H35F2N3O4 — CID 163284074
tert-butyl (3aS,6aR)-1-(3,3-dimethyl-4-oxo-4-prop-2-enoxybutyl)-2-ethyl-6,6-difluoro-3,3a,5,6a-tetrahydropyrrolo[3,2-c]pyrazole-4-carboxylate (PubChem CID 163284074) has the molecular formula C21H35F2N3O4 and a molecular weight of 431.52 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-1-(3,3-dimethyl-4-oxo-4-prop-2-enoxybutyl)-2-ethyl-6,6-difluoro-3,3a,5,6a-tetrahydropyrrolo[3,2-c]pyrazole-4-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-1-(3,3-dimethyl-4-oxo-4-prop-2-enoxybutyl)-2-ethyl-6,6-difluoro-3,3a,5,6a-tetrahydropyrrolo[3,2-c]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 163284074 |
| Molecular Formula | C21H35F2N3O4 |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | tert-butyl (3aS,6aR)-1-(3,3-dimethyl-4-oxo-4-prop-2-enoxybutyl)-2-ethyl-6,6-difluoro-3,3a,5,6a-tetrahydropyrrolo[3,2-c]pyrazole-4-carboxylate |
| SMILES | C=CCOC(=O)C(C)(C)CCN1[C@@H]2[C@H](CN1CC)N(C(=O)OC(C)(C)C)CC2(F)F |
| InChI | InChI=1S/C21H35F2N3O4/c1-8-12-29-17(27)20(6,7)10-11-26-16-15(13-24(26)9-2)25(14-21(16,22)23)18(28)30-19(3,4)5/h8,15-16H,1,9-14H2,2-7H3/t15-,16+/m0/s1 |
| InChIKey | LEUYFLBEEOAVJI-JKSUJKDBSA-N |
| XLogP | 3.31 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|