C20H33F2N3O4 — CID 167404640
tert-butyl (3aR,6aS)-1-(3,3-dimethyl-4-oxo-4-prop-2-enoxybutyl)-6,6-difluoro-2-(trideuteriomethyl)-3,3a,5,6a-tetrahydropyrrolo[3,2-c]pyrazole-4-carboxylate (PubChem CID 167404640) has the molecular formula C20H33F2N3O4 and a molecular weight of 420.52 g/mol. Its IUPAC name is tert-butyl (3aR,6aS)-1-(3,3-dimethyl-4-oxo-4-prop-2-enoxybutyl)-6,6-difluoro-2-(trideuteriomethyl)-3,3a,5,6a-tetrahydropyrrolo[3,2-c]pyrazole-4-carboxylate.
| Compound Name | tert-butyl (3aR,6aS)-1-(3,3-dimethyl-4-oxo-4-prop-2-enoxybutyl)-6,6-difluoro-2-(trideuteriomethyl)-3,3a,5,6a-tetrahydropyrrolo[3,2-c]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 167404640 |
| Molecular Formula | C20H33F2N3O4 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | tert-butyl (3aR,6aS)-1-(3,3-dimethyl-4-oxo-4-prop-2-enoxybutyl)-6,6-difluoro-2-(trideuteriomethyl)-3,3a,5,6a-tetrahydropyrrolo[3,2-c]pyrazole-4-carboxylate |
| SMILES | [2H]C([2H])([2H])N1C[C@@H]2[C@H](N1CCC(C)(C)C(=O)OCC=C)C(F)(F)CN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33F2N3O4/c1-8-11-28-16(26)19(5,6)9-10-25-15-14(12-23(25)7)24(13-20(15,21)22)17(27)29-18(2,3)4/h8,14-15H,1,9-13H2,2-7H3/t14-,15+/m1/s1/i7D3 |
| InChIKey | LTTLSYBDDRKGBF-HNEMTUTOSA-N |
| XLogP | 2.92 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|