C15H24N2O5 — CID 169199515
6-O-tert-butyl 2-O-prop-2-enyl 7-hydroxy-2,6-diazaspiro[3.4]octane-2,6-dicarboxylate (PubChem CID 169199515) has the molecular formula C15H24N2O5 and a molecular weight of 312.37 g/mol. Its IUPAC name is 6-O-tert-butyl 2-O-prop-2-enyl 7-hydroxy-2,6-diazaspiro[3.4]octane-2,6-dicarboxylate.
| Compound Name | 6-O-tert-butyl 2-O-prop-2-enyl 7-hydroxy-2,6-diazaspiro[3.4]octane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 169199515 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 6-O-tert-butyl 2-O-prop-2-enyl 7-hydroxy-2,6-diazaspiro[3.4]octane-2,6-dicarboxylate |
| SMILES | C=CCOC(=O)N1CC2(CC(O)N(C(=O)OC(C)(C)C)C2)C1 |
| InChI | InChI=1S/C15H24N2O5/c1-5-6-21-12(19)16-8-15(9-16)7-11(18)17(10-15)13(20)22-14(2,3)4/h5,11,18H,1,6-10H2,2-4H3 |
| InChIKey | KJSMSUJTTRKZID-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|