C27H26ClN3O8S-4 — CID 163285346
bis((Z)-but-2-enedioate);2-chloro-10-[3-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)propyl]phenothiazine (PubChem CID 163285346) has the molecular formula C27H26ClN3O8S-4 and a molecular weight of 596.09 g/mol. Its IUPAC name is bis((Z)-but-2-enedioate);2-chloro-10-[3-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)propyl]phenothiazine.
| Compound Name | bis((Z)-but-2-enedioate);2-chloro-10-[3-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)propyl]phenothiazine |
|---|---|
| PubChem CID | 163285346 |
| Molecular Formula | C27H26ClN3O8S-4 |
| Molecular Weight | 596.09 g/mol |
| Exact Mass | 595.17 |
| IUPAC Name | bis((Z)-but-2-enedioate);2-chloro-10-[3-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)propyl]phenothiazine |
| SMILES | O=C([O-])/C=C\C(=O)[O-].O=C([O-])/C=C\C(=O)[O-].[2H]C1([2H])NC([2H])([2H])C([2H])([2H])N(CCCN2c3ccccc3Sc3ccc(Cl)cc32)C1([2H])[2H] |
| InChI | InChI=1S/C19H22ClN3S.2C4H4O4/c20-15-6-7-19-17(14-15)23(16-4-1-2-5-18(16)24-19)11-3-10-22-12-8-21-9-13-22;2*5-3(6)1-2-4(7)8/h1-2,4-7,14,21H,3,8-13H2;2*1-2H,(H,5,6)(H,7,8)/p-4/b;2*2-1-/i8D2,9D2,12D2,13D2;; |
| InChIKey | BOYXFQZDWKVQDB-CNYBBGJVSA-J |
| XLogP | -1.68 |
| TPSA | 179.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.09 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|