C36H38Cl2N6O3 — CID 163286619
N-[(E)-but-2-enyl]-2-(4-cyclopropylpiperazin-1-yl)-5-[4-(2,6-dichloro-3,5-dimethoxyphenyl)imidazo[1,2-a][1,6]naphthyridin-8-yl]-4-methoxyaniline (PubChem CID 163286619) has the molecular formula C36H38Cl2N6O3 and a molecular weight of 673.65 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-2-(4-cyclopropylpiperazin-1-yl)-5-[4-(2,6-dichloro-3,5-dimethoxyphenyl)imidazo[1,2-a][1,6]naphthyridin-8-yl]-4-methoxyaniline.
| Compound Name | N-[(E)-but-2-enyl]-2-(4-cyclopropylpiperazin-1-yl)-5-[4-(2,6-dichloro-3,5-dimethoxyphenyl)imidazo[1,2-a][1,6]naphthyridin-8-yl]-4-methoxyaniline |
|---|---|
| PubChem CID | 163286619 |
| Molecular Formula | C36H38Cl2N6O3 |
| Molecular Weight | 673.65 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | N-[(E)-but-2-enyl]-2-(4-cyclopropylpiperazin-1-yl)-5-[4-(2,6-dichloro-3,5-dimethoxyphenyl)imidazo[1,2-a][1,6]naphthyridin-8-yl]-4-methoxyaniline |
| SMILES | C/C=C/CNc1cc(-c2cc3c(cn2)cc(-c2c(Cl)c(OC)cc(OC)c2Cl)c2nccn23)c(OC)cc1N1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C36H38Cl2N6O3/c1-5-6-9-39-27-17-24(30(45-2)19-29(27)43-14-12-42(13-15-43)23-7-8-23)26-18-28-22(21-41-26)16-25(36-40-10-11-44(28)36)33-34(37)31(46-3)20-32(47-4)35(33)38/h5-6,10-11,16-21,23,39H,7-9,12-15H2,1-4H3/b6-5+ |
| InChIKey | WSLLJZNNOLCFAI-AATRIKPKSA-N |
| XLogP | 7.82 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.65 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|