C24H32N4O13S — CID 163289930
[3,4,5-trihydroxy-6-[2-[2-[2-[4-[4-(2-oxoazetidine-1-carbonyl)phenyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl hydrogen sulfate (PubChem CID 163289930) has the molecular formula C24H32N4O13S and a molecular weight of 616.60 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-[2-[2-[2-[4-[4-(2-oxoazetidine-1-carbonyl)phenyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [3,4,5-trihydroxy-6-[2-[2-[2-[4-[4-(2-oxoazetidine-1-carbonyl)phenyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 163289930 |
| Molecular Formula | C24H32N4O13S |
| Molecular Weight | 616.60 g/mol |
| Exact Mass | 616.17 |
| IUPAC Name | [3,4,5-trihydroxy-6-[2-[2-[2-[4-[4-(2-oxoazetidine-1-carbonyl)phenyl]triazol-1-yl]ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl hydrogen sulfate |
| SMILES | O=C1CCN1C(=O)c1ccc(-c2cn(CCOCCOCCOC3OC(COS(=O)(=O)O)C(O)C(O)C3O)nn2)cc1 |
| InChI | InChI=1S/C24H32N4O13S/c29-19-5-6-28(19)23(33)16-3-1-15(2-4-16)17-13-27(26-25-17)7-8-37-9-10-38-11-12-39-24-22(32)21(31)20(30)18(41-24)14-40-42(34,35)36/h1-4,13,18,20-22,24,30-32H,5-12,14H2,(H,34,35,36) |
| InChIKey | CVDLPYIPLCHCEC-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 229.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.60 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|