C19H24N4O4 — CID 163293214
3-[(3S)-3-[(2S)-butan-2-yl]-2-oxo-3,5-dihydro-1H-pyrido[3,4-e][1,4]diazepin-4-yl]-4-(2-methoxyethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 163293214) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 3-[(3S)-3-[(2S)-butan-2-yl]-2-oxo-3,5-dihydro-1H-pyrido[3,4-e][1,4]diazepin-4-yl]-4-(2-methoxyethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(3S)-3-[(2S)-butan-2-yl]-2-oxo-3,5-dihydro-1H-pyrido[3,4-e][1,4]diazepin-4-yl]-4-(2-methoxyethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 163293214 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 3-[(3S)-3-[(2S)-butan-2-yl]-2-oxo-3,5-dihydro-1H-pyrido[3,4-e][1,4]diazepin-4-yl]-4-(2-methoxyethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CC[C@H](C)[C@H]1C(=O)Nc2cnccc2CN1c1c(NCCOC)c(=O)c1=O |
| InChI | InChI=1S/C19H24N4O4/c1-4-11(2)15-19(26)22-13-9-20-6-5-12(13)10-23(15)16-14(17(24)18(16)25)21-7-8-27-3/h5-6,9,11,15,21H,4,7-8,10H2,1-3H3,(H,22,26)/t11-,15-/m0/s1 |
| InChIKey | WOQRZBABJGIVQK-NHYWBVRUSA-N |
| XLogP | 1.11 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|