C25H28N4O6 — CID 163294156
(1S,5R)-3-[[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-4-hydroxypiperidin-4-yl]methyl]-3-azabicyclo[3.1.0]hexane-6-carbaldehyde (PubChem CID 163294156) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is (1S,5R)-3-[[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-4-hydroxypiperidin-4-yl]methyl]-3-azabicyclo[3.1.0]hexane-6-carbaldehyde.
| Compound Name | (1S,5R)-3-[[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-4-hydroxypiperidin-4-yl]methyl]-3-azabicyclo[3.1.0]hexane-6-carbaldehyde |
|---|---|
| PubChem CID | 163294156 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | (1S,5R)-3-[[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-4-hydroxypiperidin-4-yl]methyl]-3-azabicyclo[3.1.0]hexane-6-carbaldehyde |
| SMILES | O=CC1[C@H]2CN(CC3(O)CCN(c4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)C[C@@H]12 |
| InChI | InChI=1S/C25H28N4O6/c30-12-19-17-10-27(11-18(17)19)13-25(35)5-7-28(8-6-25)14-1-2-15-16(9-14)24(34)29(23(15)33)20-3-4-21(31)26-22(20)32/h1-2,9,12,17-20,35H,3-8,10-11,13H2,(H,26,31,32)/t17-,18+,19?,20? |
| InChIKey | XUAGQNXNKLSWKX-VCWRXUFXSA-N |
| XLogP | -0.20 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|