C20H29FN6O — CID 163294362
2-[(Z)-1-amino-2-(7-amino-2-piperidin-4-yl-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-6-yl)ethenyl]-4-fluorophenol (PubChem CID 163294362) has the molecular formula C20H29FN6O and a molecular weight of 388.49 g/mol. Its IUPAC name is 2-[(Z)-1-amino-2-(7-amino-2-piperidin-4-yl-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-6-yl)ethenyl]-4-fluorophenol.
| Compound Name | 2-[(Z)-1-amino-2-(7-amino-2-piperidin-4-yl-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-6-yl)ethenyl]-4-fluorophenol |
|---|---|
| PubChem CID | 163294362 |
| Molecular Formula | C20H29FN6O |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 2-[(Z)-1-amino-2-(7-amino-2-piperidin-4-yl-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-6-yl)ethenyl]-4-fluorophenol |
| SMILES | NC1=C(/C=C(\N)c2cc(F)ccc2O)N2CCN(C3CCNCC3)CC2CN1 |
| InChI | InChI=1S/C20H29FN6O/c21-13-1-2-19(28)16(9-13)17(22)10-18-20(23)25-11-15-12-26(7-8-27(15)18)14-3-5-24-6-4-14/h1-2,9-10,14-15,24-25,28H,3-8,11-12,22-23H2/b17-10- |
| InChIKey | LSFAPSNOLTYDTE-YVLHZVERSA-N |
| XLogP | 0.30 |
| TPSA | 102.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |