C36H41N9O5 — CID 163294573
2-(2,6-dioxopiperidin-3-yl)-4-[3-[4-[(10S)-4-(2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]piperidin-1-yl]propylamino]isoindole-1,3-dione (PubChem CID 163294573) has the molecular formula C36H41N9O5 and a molecular weight of 679.78 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[3-[4-[(10S)-4-(2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]piperidin-1-yl]propylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[3-[4-[(10S)-4-(2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]piperidin-1-yl]propylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 163294573 |
| Molecular Formula | C36H41N9O5 |
| Molecular Weight | 679.78 g/mol |
| Exact Mass | 679.32 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[3-[4-[(10S)-4-(2-hydroxyphenyl)-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]piperidin-1-yl]propylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCN4CCC(N5CCN6c7cc(-c8ccccc8O)nnc7NC[C@H]6C5)CC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C36H41N9O5/c46-30-8-2-1-5-24(30)27-19-29-33(41-40-27)38-20-23-21-43(17-18-44(23)29)22-11-15-42(16-12-22)14-4-13-37-26-7-3-6-25-32(26)36(50)45(35(25)49)28-9-10-31(47)39-34(28)48/h1-3,5-8,19,22-23,28,37,46H,4,9-18,20-21H2,(H,38,41)(H,39,47,48)/t23-,28?/m0/s1 |
| InChIKey | FFROYMHZFBQWSV-UHFKCPIBSA-N |
| XLogP | 2.13 |
| TPSA | 163.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.78 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|