C24H27FN4O4 — CID 163294617
5-[(4R)-4-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-3-fluoropiperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 163294617) has the molecular formula C24H27FN4O4 and a molecular weight of 454.50 g/mol. Its IUPAC name is 5-[(4R)-4-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-3-fluoropiperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[(4R)-4-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-3-fluoropiperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 163294617 |
| Molecular Formula | C24H27FN4O4 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 5-[(4R)-4-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-3-fluoropiperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CC[C@H](CN5CC6CC6C5)C(F)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H27FN4O4/c25-19-12-28(6-5-13(19)9-27-10-14-7-15(14)11-27)16-1-2-17-18(8-16)24(33)29(23(17)32)20-3-4-21(30)26-22(20)31/h1-2,8,13-15,19-20H,3-7,9-12H2,(H,26,30,31)/t13-,14?,15?,19?,20?/m1/s1 |
| InChIKey | OPWJCGFQOCGOHW-ZWQILZKASA-N |
| XLogP | 1.20 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|