C14H23F3N2OS — CID 163294653
N-[[4-(cyanomethyl)-4-(trifluoromethyl)cyclohexyl]methyl]-2-methylpropane-2-sulfinamide (PubChem CID 163294653) has the molecular formula C14H23F3N2OS and a molecular weight of 324.41 g/mol. Its IUPAC name is N-[[4-(cyanomethyl)-4-(trifluoromethyl)cyclohexyl]methyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[[4-(cyanomethyl)-4-(trifluoromethyl)cyclohexyl]methyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 163294653 |
| Molecular Formula | C14H23F3N2OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[[4-(cyanomethyl)-4-(trifluoromethyl)cyclohexyl]methyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NCC1CCC(CC#N)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H23F3N2OS/c1-12(2,3)21(20)19-10-11-4-6-13(7-5-11,8-9-18)14(15,16)17/h11,19H,4-8,10H2,1-3H3 |
| InChIKey | YTWBQDKWRVZNEU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |