C12H19F3N2OS — CID 167064890
N-[4-cyano-4-(trifluoromethyl)cyclohexyl]-2-methylpropane-2-sulfinamide (PubChem CID 167064890) has the molecular formula C12H19F3N2OS and a molecular weight of 296.36 g/mol. Its IUPAC name is N-[4-cyano-4-(trifluoromethyl)cyclohexyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[4-cyano-4-(trifluoromethyl)cyclohexyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 167064890 |
| Molecular Formula | C12H19F3N2OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-[4-cyano-4-(trifluoromethyl)cyclohexyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NC1CCC(C#N)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H19F3N2OS/c1-10(2,3)19(18)17-9-4-6-11(8-16,7-5-9)12(13,14)15/h9,17H,4-7H2,1-3H3 |
| InChIKey | WMEUZNZZVLGXBC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |